C18H18F2O3 — CID 164915429
[2-(diethoxymethyl)phenyl]-(2,3-difluorophenyl)methanone (PubChem CID 164915429) has the molecular formula C18H18F2O3 and a molecular weight of 320.34 g/mol. Its IUPAC name is [2-(diethoxymethyl)phenyl]-(2,3-difluorophenyl)methanone.
| Compound Name | [2-(diethoxymethyl)phenyl]-(2,3-difluorophenyl)methanone |
|---|---|
| PubChem CID | 164915429 |
| Molecular Formula | C18H18F2O3 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-(diethoxymethyl)phenyl]-(2,3-difluorophenyl)methanone |
| SMILES | CCOC(OCC)c1ccccc1C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C18H18F2O3/c1-3-22-18(23-4-2)13-9-6-5-8-12(13)17(21)14-10-7-11-15(19)16(14)20/h5-11,18H,3-4H2,1-2H3 |
| InChIKey | LTUAYYOVNLPWFC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|