C23H24N4 — CID 164915522
(1S)-1-[2-(1-propan-2-ylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine (PubChem CID 164915522) has the molecular formula C23H24N4 and a molecular weight of 356.47 g/mol. Its IUPAC name is (1S)-1-[2-(1-propan-2-ylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine.
| Compound Name | (1S)-1-[2-(1-propan-2-ylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 164915522 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1S)-1-[2-(1-propan-2-ylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine |
| SMILES | CC(C)n1nc(-c2ccccc2[C@@H](N)Cc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C23H24N4/c1-16(2)27-22-13-6-5-12-20(22)23(26-27)19-11-4-3-10-18(19)21(24)15-17-9-7-8-14-25-17/h3-14,16,21H,15,24H2,1-2H3/t21-/m0/s1 |
| InChIKey | PEZGJMVPHPLSDL-NRFANRHFSA-N |
| XLogP | 4.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |