C21H21ClN4 — CID 174205179
1-[2-(1-methylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine;hydrochloride (PubChem CID 174205179) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 1-[2-(1-methylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine;hydrochloride.
| Compound Name | 1-[2-(1-methylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 174205179 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[2-(1-methylindazol-3-yl)phenyl]-2-pyridin-2-ylethanamine;hydrochloride |
| SMILES | Cl.Cn1nc(-c2ccccc2C(N)Cc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C21H20N4.ClH/c1-25-20-12-5-4-11-18(20)21(24-25)17-10-3-2-9-16(17)19(22)14-15-8-6-7-13-23-15;/h2-13,19H,14,22H2,1H3;1H |
| InChIKey | CMTZXNCINYSVOI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |