About 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile
4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile (PubChem CID 164916746) has the molecular formula C17H9ClF2N2O
and a molecular weight of 330.72 g/mol. Its IUPAC name is 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile |
| PubChem CID | 164916746 |
| Molecular Formula | C17H9ClF2N2O |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile |
| SMILES | Cc1c(F)cc2[nH]c(-c3cc(C#N)ccc3Cl)cc(=O)c2c1F |
| InChI | InChI=1S/C17H9ClF2N2O/c1-8-12(19)5-14-16(17(8)20)15(23)6-13(22-14)10-4-9(7-21)2-3-11(10)18/h2-6H,1H3,(H,22,23) |
| InChIKey | JRWSRENQCZCEKW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile?
The IUPAC name of 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile (CID 164916746) is 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile.
What is the SMILES notation for 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile?
The canonical SMILES for 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile is Cc1c(F)cc2[nH]c(-c3cc(C#N)ccc3Cl)cc(=O)c2c1F.
What is the InChIKey of 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile?
The InChIKey is JRWSRENQCZCEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF2N2O/c1-8-12(19)5-14-16(17(8)20)15(23)6-13(22-14)10-4-9(7-21)2-3-11(10)18/h2-6H,1H3,(H,22,23).
What are the key properties of 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile?
4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile has a molecular weight of 330.72 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(5,7-difluoro-6-methyl-4-oxo-1H-quinolin-2-yl)benzonitrile is sourced from PubChem (CID 164916746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).