C16H6ClF3N2O — CID 164916772
4-chloro-3-(5,6,7-trifluoro-4-oxo-1H-quinolin-2-yl)benzonitrile (PubChem CID 164916772) has the molecular formula C16H6ClF3N2O and a molecular weight of 334.68 g/mol. Its IUPAC name is 4-chloro-3-(5,6,7-trifluoro-4-oxo-1H-quinolin-2-yl)benzonitrile.
| Compound Name | 4-chloro-3-(5,6,7-trifluoro-4-oxo-1H-quinolin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 164916772 |
| Molecular Formula | C16H6ClF3N2O |
| Molecular Weight | 334.68 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4-chloro-3-(5,6,7-trifluoro-4-oxo-1H-quinolin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(-c2cc(=O)c3c(F)c(F)c(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C16H6ClF3N2O/c17-9-2-1-7(6-21)3-8(9)11-5-13(23)14-12(22-11)4-10(18)15(19)16(14)20/h1-5H,(H,22,23) |
| InChIKey | VJBKDQUFDOJDNK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|