About 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile
4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile (PubChem CID 164916800) has the molecular formula C20H15ClF2N4O
and a molecular weight of 400.82 g/mol. Its IUPAC name is 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile |
| PubChem CID | 164916800 |
| Molecular Formula | C20H15ClF2N4O |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(-c2cc(=O)c3c(F)c(N4CCNCC4)c(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C20H15ClF2N4O/c21-13-2-1-11(10-24)7-12(13)15-9-17(28)18-16(26-15)8-14(22)20(19(18)23)27-5-3-25-4-6-27/h1-2,7-9,25H,3-6H2,(H,26,28) |
| InChIKey | ZWCHAUZAZSRHCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile?
The IUPAC name of 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile (CID 164916800) is 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile.
What is the SMILES notation for 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile?
The canonical SMILES for 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile is N#Cc1ccc(Cl)c(-c2cc(=O)c3c(F)c(N4CCNCC4)c(F)cc3[nH]2)c1.
What is the InChIKey of 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile?
The InChIKey is ZWCHAUZAZSRHCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClF2N4O/c21-13-2-1-11(10-24)7-12(13)15-9-17(28)18-16(26-15)8-14(22)20(19(18)23)27-5-3-25-4-6-27/h1-2,7-9,25H,3-6H2,(H,26,28).
What are the key properties of 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile?
4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile has a molecular weight of 400.82 g/mol, XLogP of 3.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(5,7-difluoro-4-oxo-6-piperazin-1-yl-1H-quinolin-2-yl)benzonitrile is sourced from PubChem (CID 164916800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).