C26H23F5N6O2 — CID 164917232
N-[(1E,3Z)-2-[4-[[3-(1,1-difluoro-2-hydroxyethyl)phenyl]methylamino]-7-methyl-2-(trifluoromethyl)pyrazolo[3,4-h]quinazolin-6-yl]penta-1,3-dienyl]formamide (PubChem CID 164917232) has the molecular formula C26H23F5N6O2 and a molecular weight of 546.50 g/mol. Its IUPAC name is N-[(1E,3Z)-2-[4-[[3-(1,1-difluoro-2-hydroxyethyl)phenyl]methylamino]-7-methyl-2-(trifluoromethyl)pyrazolo[3,4-h]quinazolin-6-yl]penta-1,3-dienyl]formamide.
| Compound Name | N-[(1E,3Z)-2-[4-[[3-(1,1-difluoro-2-hydroxyethyl)phenyl]methylamino]-7-methyl-2-(trifluoromethyl)pyrazolo[3,4-h]quinazolin-6-yl]penta-1,3-dienyl]formamide |
|---|---|
| PubChem CID | 164917232 |
| Molecular Formula | C26H23F5N6O2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-[(1E,3Z)-2-[4-[[3-(1,1-difluoro-2-hydroxyethyl)phenyl]methylamino]-7-methyl-2-(trifluoromethyl)pyrazolo[3,4-h]quinazolin-6-yl]penta-1,3-dienyl]formamide |
| SMILES | C/C=C\C(=C/NC=O)c1cc2c(NCc3cccc(C(F)(F)CO)c3)nc(C(F)(F)F)nc2c2cnn(C)c12 |
| InChI | InChI=1S/C26H23F5N6O2/c1-3-5-16(11-32-14-39)18-9-19-21(20-12-34-37(2)22(18)20)35-24(26(29,30)31)36-23(19)33-10-15-6-4-7-17(8-15)25(27,28)13-38/h3-9,11-12,14,38H,10,13H2,1-2H3,(H,32,39)(H,33,35,36)/b5-3-,16-11+ |
| InChIKey | PCRHHKPXDPDARG-WFMCAJBGSA-N |
| XLogP | 4.89 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|