About (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite
(5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite (PubChem CID 164917402) has the molecular formula C7H6FN3OS
and a molecular weight of 199.21 g/mol. Its IUPAC name is (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite.
Analyze (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite?
The IUPAC name of (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite (CID 164917402) is (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite.
What is the SMILES notation for (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite?
The canonical SMILES for (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite is Cn1ccc2c(cnn2SF)c1=O.
What is the InChIKey of (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite?
The InChIKey is PPWVASXCJMNTFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN3OS/c1-10-3-2-6-5(7(10)12)4-9-11(6)13-8/h2-4H,1H3.
What are the key properties of (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite?
(5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite has a molecular weight of 199.21 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-4-oxopyrazolo[4,5-c]pyridin-1-yl) thiohypofluorite is sourced from PubChem (CID 164917402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).