About (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate
(4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate (PubChem CID 164917537) has the molecular formula C20H27NO5S
and a molecular weight of 393.51 g/mol. Its IUPAC name is (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate.
Molecular Properties
| Compound Name | (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate |
| PubChem CID | 164917537 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate |
| SMILES | CCCCCNC(O)c1ccc(OS(=O)(=O)Oc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C20H27NO5S/c1-3-5-6-15-21-20(22)17-9-13-19(14-10-17)26-27(23,24)25-18-11-7-16(4-2)8-12-18/h7-14,20-22H,3-6,15H2,1-2H3 |
| InChIKey | HKHHQQYCTUTOLS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate?
The IUPAC name of (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate (CID 164917537) is (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate.
What is the SMILES notation for (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate?
The canonical SMILES for (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate is CCCCCNC(O)c1ccc(OS(=O)(=O)Oc2ccc(CC)cc2)cc1.
What is the InChIKey of (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate?
The InChIKey is HKHHQQYCTUTOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO5S/c1-3-5-6-15-21-20(22)17-9-13-19(14-10-17)26-27(23,24)25-18-11-7-16(4-2)8-12-18/h7-14,20-22H,3-6,15H2,1-2H3.
What are the key properties of (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate?
(4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate has a molecular weight of 393.51 g/mol, XLogP of 3.72, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl) [4-[hydroxy-(pentylamino)methyl]phenyl] sulfate is sourced from PubChem (CID 164917537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).