C28H40BaN2O12S2 — CID 88703021
barium(2+);bis((2S)-2-(pentylamino)-3-(4-sulfooxyphenyl)propanoate) (PubChem CID 88703021) has the molecular formula C28H40BaN2O12S2 and a molecular weight of 798.09 g/mol. Its IUPAC name is barium(2+);bis((2S)-2-(pentylamino)-3-(4-sulfooxyphenyl)propanoate).
| Compound Name | barium(2+);bis((2S)-2-(pentylamino)-3-(4-sulfooxyphenyl)propanoate) |
|---|---|
| PubChem CID | 88703021 |
| Molecular Formula | C28H40BaN2O12S2 |
| Molecular Weight | 798.09 g/mol |
| Exact Mass | 798.11 |
| IUPAC Name | barium(2+);bis((2S)-2-(pentylamino)-3-(4-sulfooxyphenyl)propanoate) |
| SMILES | CCCCCN[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)[O-].CCCCCN[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C14H21NO6S.Ba/c2*1-2-3-4-9-15-13(14(16)17)10-11-5-7-12(8-6-11)21-22(18,19)20;/h2*5-8,13,15H,2-4,9-10H2,1H3,(H,16,17)(H,18,19,20);/q;;+2/p-2/t2*13-;/m00./s1 |
| InChIKey | ZYJFIQHEYDBMCD-DHHADUQMSA-L |
| XLogP | 0.24 |
| TPSA | 231.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.09 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|