About [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate
[bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate (PubChem CID 141091336) has the molecular formula C24H27NO12S3
and a molecular weight of 617.68 g/mol. Its IUPAC name is [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate.
Molecular Properties
| Compound Name | [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate |
| PubChem CID | 141091336 |
| Molecular Formula | C24H27NO12S3 |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate |
| SMILES | CCc1ccc(OS(=O)(=O)ON(OS(=O)(=O)Oc2ccc(CC)cc2)OS(=O)(=O)Oc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C24H27NO12S3/c1-4-19-7-13-22(14-8-19)32-38(26,27)35-25(36-39(28,29)33-23-15-9-20(5-2)10-16-23)37-40(30,31)34-24-17-11-21(6-3)12-18-24/h7-18H,4-6H2,1-3H3 |
| InChIKey | HTVUMPGILOQPLY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate?
The IUPAC name of [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate (CID 141091336) is [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate.
What is the SMILES notation for [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate?
The canonical SMILES for [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate is CCc1ccc(OS(=O)(=O)ON(OS(=O)(=O)Oc2ccc(CC)cc2)OS(=O)(=O)Oc2ccc(CC)cc2)cc1.
What is the InChIKey of [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate?
The InChIKey is HTVUMPGILOQPLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO12S3/c1-4-19-7-13-22(14-8-19)32-38(26,27)35-25(36-39(28,29)33-23-15-9-20(5-2)10-16-23)37-40(30,31)34-24-17-11-21(6-3)12-18-24/h7-18H,4-6H2,1-3H3.
What are the key properties of [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate?
[bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate has a molecular weight of 617.68 g/mol, XLogP of 3.74, 15 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for [bis[(4-ethylphenoxy)sulfonyloxy]amino] (4-ethylphenyl) sulfate is sourced from PubChem (CID 141091336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).