About alumane;1-ethyl-4-phosphorosooxybenzene
alumane;1-ethyl-4-phosphorosooxybenzene (PubChem CID 175477629) has the molecular formula C8H12AlO2P
and a molecular weight of 198.14 g/mol. Its IUPAC name is alumane;1-ethyl-4-phosphorosooxybenzene.
Molecular Properties
| Compound Name | alumane;1-ethyl-4-phosphorosooxybenzene |
| PubChem CID | 175477629 |
| Molecular Formula | C8H12AlO2P |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | alumane;1-ethyl-4-phosphorosooxybenzene |
| SMILES | CCc1ccc(OP=O)cc1.[AlH3] |
| InChI | InChI=1S/C8H9O2P.Al.3H/c1-2-7-3-5-8(6-4-7)10-11-9;;;;/h3-6H,2H2,1H3;;;; |
| InChIKey | YDWKDIRKRHIZGR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;1-ethyl-4-phosphorosooxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;1-ethyl-4-phosphorosooxybenzene?
The IUPAC name of alumane;1-ethyl-4-phosphorosooxybenzene (CID 175477629) is alumane;1-ethyl-4-phosphorosooxybenzene.
What is the SMILES notation for alumane;1-ethyl-4-phosphorosooxybenzene?
The canonical SMILES for alumane;1-ethyl-4-phosphorosooxybenzene is CCc1ccc(OP=O)cc1.[AlH3].
What is the InChIKey of alumane;1-ethyl-4-phosphorosooxybenzene?
The InChIKey is YDWKDIRKRHIZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2P.Al.3H/c1-2-7-3-5-8(6-4-7)10-11-9;;;;/h3-6H,2H2,1H3;;;;.
What are the key properties of alumane;1-ethyl-4-phosphorosooxybenzene?
alumane;1-ethyl-4-phosphorosooxybenzene has a molecular weight of 198.14 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;1-ethyl-4-phosphorosooxybenzene is sourced from PubChem (CID 175477629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).