C23H39ClN2 — CID 164917667
1,3-bis(2,4,4-trimethylpentan-2-yl)benzimidazol-3-ium chloride (PubChem CID 164917667) has the molecular formula C23H39ClN2 and a molecular weight of 379.03 g/mol. Its IUPAC name is 1,3-bis(2,4,4-trimethylpentan-2-yl)benzimidazol-3-ium chloride.
| Compound Name | 1,3-bis(2,4,4-trimethylpentan-2-yl)benzimidazol-3-ium chloride |
|---|---|
| PubChem CID | 164917667 |
| Molecular Formula | C23H39ClN2 |
| Molecular Weight | 379.03 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 1,3-bis(2,4,4-trimethylpentan-2-yl)benzimidazol-3-ium chloride |
| SMILES | CC(C)(C)CC(C)(C)n1c[n+](C(C)(C)CC(C)(C)C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C23H39N2.ClH/c1-20(2,3)15-22(7,8)24-17-25(19-14-12-11-13-18(19)24)23(9,10)16-21(4,5)6;/h11-14,17H,15-16H2,1-10H3;1H/q+1;/p-1 |
| InChIKey | IVGBTUCNWBOROK-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.03 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|