C15H23F2NO — CID 164918323
2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine (PubChem CID 164918323) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine.
| Compound Name | 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine |
|---|---|
| PubChem CID | 164918323 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine |
| SMILES | C=C/C(=C\C(=C)C(C)C)C(F)(F)C1CN(C)CCO1 |
| InChI | InChI=1S/C15H23F2NO/c1-6-13(9-12(4)11(2)3)15(16,17)14-10-18(5)7-8-19-14/h6,9,11,14H,1,4,7-8,10H2,2-3,5H3/b13-9+ |
| InChIKey | RNPVOFZZIHYKHP-UKTHLTGXSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|