About 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine
2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine (PubChem CID 164918323) has the molecular formula C15H23F2NO
and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine.
Molecular Properties
| Compound Name | 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine |
| PubChem CID | 164918323 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine |
| SMILES | C=C/C(=C\C(=C)C(C)C)C(F)(F)C1CN(C)CCO1 |
| InChI | InChI=1S/C15H23F2NO/c1-6-13(9-12(4)11(2)3)15(16,17)14-10-18(5)7-8-19-14/h6,9,11,14H,1,4,7-8,10H2,2-3,5H3/b13-9+ |
| InChIKey | RNPVOFZZIHYKHP-UKTHLTGXSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine?
The IUPAC name of 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine (CID 164918323) is 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine.
What is the SMILES notation for 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine?
The canonical SMILES for 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine is C=C/C(=C\C(=C)C(C)C)C(F)(F)C1CN(C)CCO1.
What is the InChIKey of 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine?
The InChIKey is RNPVOFZZIHYKHP-UKTHLTGXSA-N. The full InChI is InChI=1S/C15H23F2NO/c1-6-13(9-12(4)11(2)3)15(16,17)14-10-18(5)7-8-19-14/h6,9,11,14H,1,4,7-8,10H2,2-3,5H3/b13-9+.
What are the key properties of 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine?
2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine has a molecular weight of 271.35 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-ethenyl-1,1-difluoro-5-methyl-4-methylidenehex-2-enyl]-4-methylmorpholine is sourced from PubChem (CID 164918323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).