C26H27F3N4O4S — CID 164918390
N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-[(1,1-dioxo-2,3,6,7-tetrahydrothiepin-4-yl)methyl]-7-(oxetan-3-yloxy)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 164918390) has the molecular formula C26H27F3N4O4S and a molecular weight of 548.59 g/mol. Its IUPAC name is N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-[(1,1-dioxo-2,3,6,7-tetrahydrothiepin-4-yl)methyl]-7-(oxetan-3-yloxy)pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-[(1,1-dioxo-2,3,6,7-tetrahydrothiepin-4-yl)methyl]-7-(oxetan-3-yloxy)pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164918390 |
| Molecular Formula | C26H27F3N4O4S |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-[(1,1-dioxo-2,3,6,7-tetrahydrothiepin-4-yl)methyl]-7-(oxetan-3-yloxy)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H](Nc1ncnc2nc(OC3COC3)c(CC3=CCCS(=O)(=O)CC3)cc12)c1cccc(C(F)F)c1F |
| InChI | InChI=1S/C26H27F3N4O4S/c1-15(19-5-2-6-20(22(19)27)23(28)29)32-24-21-11-17(10-16-4-3-8-38(34,35)9-7-16)26(37-18-12-36-13-18)33-25(21)31-14-30-24/h2,4-6,11,14-15,18,23H,3,7-10,12-13H2,1H3,(H,30,31,32,33)/t15-/m1/s1 |
| InChIKey | ZGFWHMDDCUNNCR-OAHLLOKOSA-N |
| XLogP | 4.73 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|