C21H23N7O — CID 164920397
6-[(Z)-3-[(1-cyano-5,5-dimethylpyrrolidin-3-yl)methylideneamino]-1-iminobut-2-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164920397) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 6-[(Z)-3-[(1-cyano-5,5-dimethylpyrrolidin-3-yl)methylideneamino]-1-iminobut-2-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-3-[(1-cyano-5,5-dimethylpyrrolidin-3-yl)methylideneamino]-1-iminobut-2-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164920397 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 6-[(Z)-3-[(1-cyano-5,5-dimethylpyrrolidin-3-yl)methylideneamino]-1-iminobut-2-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | [H]/N=C/C(=C(C)\N=C\C1CN(C#N)C(C)(C)C1)c1cc(OC)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C21H23N7O/c1-14(25-9-15-6-21(2,3)27(11-15)13-24)18(8-23)16-5-19(29-4)20-17(7-22)10-26-28(20)12-16/h5,8-10,12,15,23H,6,11H2,1-4H3/b18-14+,23-8+,25-9+ |
| InChIKey | HHJWFVOXIFSSQA-CLHNXFNESA-N |
| XLogP | 3.25 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|