C19H28N2O — CID 164923692
2-(3-phenyl-3,10-diazaspiro[5.7]tridecan-10-yl)acetaldehyde (PubChem CID 164923692) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-(3-phenyl-3,10-diazaspiro[5.7]tridecan-10-yl)acetaldehyde.
| Compound Name | 2-(3-phenyl-3,10-diazaspiro[5.7]tridecan-10-yl)acetaldehyde |
|---|---|
| PubChem CID | 164923692 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-(3-phenyl-3,10-diazaspiro[5.7]tridecan-10-yl)acetaldehyde |
| SMILES | O=CCN1CCCC2(CCC1)CCN(c1ccccc1)CC2 |
| InChI | InChI=1S/C19H28N2O/c22-17-16-20-12-4-8-19(9-5-13-20)10-14-21(15-11-19)18-6-2-1-3-7-18/h1-3,6-7,17H,4-5,8-16H2 |
| InChIKey | MLGGQSTYYNBZJW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|