C36H51F4N3O — CID 164924084
1-[4-[4-[2-[butyl(2-methylidenepentyl)amino]ethyl]azepan-1-yl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 164924084) has the molecular formula C36H51F4N3O and a molecular weight of 617.82 g/mol. Its IUPAC name is 1-[4-[4-[2-[butyl(2-methylidenepentyl)amino]ethyl]azepan-1-yl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | 1-[4-[4-[2-[butyl(2-methylidenepentyl)amino]ethyl]azepan-1-yl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 164924084 |
| Molecular Formula | C36H51F4N3O |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | 1-[4-[4-[2-[butyl(2-methylidenepentyl)amino]ethyl]azepan-1-yl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | C=C(CCC)CN(CCCC)CCC1CCCN(c2cc(F)c(C3c4ccc(O)cc4CCN3CC(C)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C36H51F4N3O/c1-5-7-16-41(24-26(3)9-6-2)18-13-27-10-8-17-42(19-14-27)29-22-32(37)34(33(38)23-29)35-31-12-11-30(44)21-28(31)15-20-43(35)25-36(4,39)40/h11-12,21-23,27,35,44H,3,5-10,13-20,24-25H2,1-2,4H3 |
| InChIKey | HHFPQCGCIRVXDO-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|