C35H47F4N3 — CID 170959918
7-but-1-en-2-yl-1-[4-[(1-butylpyrrolidin-3-yl)methyl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane (PubChem CID 170959918) has the molecular formula C35H47F4N3 and a molecular weight of 585.77 g/mol. Its IUPAC name is 7-but-1-en-2-yl-1-[4-[(1-butylpyrrolidin-3-yl)methyl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane.
| Compound Name | 7-but-1-en-2-yl-1-[4-[(1-butylpyrrolidin-3-yl)methyl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane |
|---|---|
| PubChem CID | 170959918 |
| Molecular Formula | C35H47F4N3 |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.37 |
| IUPAC Name | 7-but-1-en-2-yl-1-[4-[(1-butylpyrrolidin-3-yl)methyl]-2,6-difluorophenyl]-2-(2,2-difluoropropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane |
| SMILES | C=C(CC)c1ccc2c3c([nH]c2c1)C(c1c(F)cc(CC2CCN(CCCC)C2)cc1F)N(CC(C)(F)F)CC3.CC |
| InChI | InChI=1S/C33H41F4N3.C2H6/c1-5-7-12-39-13-10-22(19-39)15-23-16-27(34)30(28(35)17-23)32-31-26(11-14-40(32)20-33(4,36)37)25-9-8-24(21(3)6-2)18-29(25)38-31;1-2/h8-9,16-18,22,32,38H,3,5-7,10-15,19-20H2,1-2,4H3;1-2H3 |
| InChIKey | ADOUODDCFZPBNW-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|