C30H34F5N3O2 — CID 170959911
methyl 1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]phenyl]-2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-7-carboxylate (PubChem CID 170959911) has the molecular formula C30H34F5N3O2 and a molecular weight of 563.61 g/mol. Its IUPAC name is methyl 1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]phenyl]-2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-7-carboxylate.
| Compound Name | methyl 1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]phenyl]-2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 170959911 |
| Molecular Formula | C30H34F5N3O2 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | methyl 1-[2,6-difluoro-4-[[1-(3-fluoropropyl)azetidin-3-yl]methyl]phenyl]-2-(2,2-difluoropropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c3c([nH]c2c1)C(c1c(F)cc(CC2CN(CCCF)C2)cc1F)N(CC(C)(F)F)C(C)C3 |
| InChI | InChI=1S/C30H34F5N3O2/c1-17-9-22-21-6-5-20(29(39)40-3)13-25(21)36-27(22)28(38(17)16-30(2,34)35)26-23(32)11-18(12-24(26)33)10-19-14-37(15-19)8-4-7-31/h5-6,11-13,17,19,28,36H,4,7-10,14-16H2,1-3H3 |
| InChIKey | SXPHUKOZGJQTCG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|