C30H33F6N3 — CID 170959915
(3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-7-ethenyl-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 170959915) has the molecular formula C30H33F6N3 and a molecular weight of 549.60 g/mol. Its IUPAC name is (3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-7-ethenyl-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-7-ethenyl-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170959915 |
| Molecular Formula | C30H33F6N3 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | (3R)-1-[2,6-difluoro-4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-7-ethenyl-3-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=Cc1ccc2c3c([nH]c2c1)C(c1c(F)cc(CC2CCN(CCCF)C2)cc1F)N(CC(F)(F)F)[C@H](C)C3 |
| InChI | InChI=1S/C30H33F6N3/c1-3-19-5-6-22-23-11-18(2)39(17-30(34,35)36)29(28(23)37-26(22)15-19)27-24(32)13-21(14-25(27)33)12-20-7-10-38(16-20)9-4-8-31/h3,5-6,13-15,18,20,29,37H,1,4,7-12,16-17H2,2H3/t18-,20?,29?/m1/s1 |
| InChIKey | QRHANVSEKOZDKF-OZJAZRDFSA-N |
| XLogP | 7.21 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|