C32H42F5N3 — CID 170959891
(3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole;1-(3-fluoropropyl)-3-methylpyrrolidine (PubChem CID 170959891) has the molecular formula C32H42F5N3 and a molecular weight of 563.70 g/mol. Its IUPAC name is (3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole;1-(3-fluoropropyl)-3-methylpyrrolidine.
| Compound Name | (3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole;1-(3-fluoropropyl)-3-methylpyrrolidine |
|---|---|
| PubChem CID | 170959891 |
| Molecular Formula | C32H42F5N3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | (3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole;1-(3-fluoropropyl)-3-methylpyrrolidine |
| SMILES | C=CC1=Cc2[nH]c3c(c2CC1)C[C@@H](C)N(CC(C)(F)F)C3c1c(F)cc(C)cc1F.CC1CCN(CCCF)C1 |
| InChI | InChI=1S/C24H26F4N2.C8H16FN/c1-5-15-6-7-16-17-10-14(3)30(12-24(4,27)28)23(22(17)29-20(16)11-15)21-18(25)8-13(2)9-19(21)26;1-8-3-6-10(7-8)5-2-4-9/h5,8-9,11,14,23,29H,1,6-7,10,12H2,2-4H3;8H,2-7H2,1H3/t14-,23?;/m1./s1 |
| InChIKey | HEZGDFCOUKAAQK-QMXUPHEDSA-N |
| XLogP | 7.80 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |