C24H26F4N2 — CID 170959892
(3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole (PubChem CID 170959892) has the molecular formula C24H26F4N2 and a molecular weight of 418.48 g/mol. Its IUPAC name is (3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole.
| Compound Name | (3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170959892 |
| Molecular Formula | C24H26F4N2 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (3R)-1-(2,6-difluoro-4-methylphenyl)-2-(2,2-difluoropropyl)-7-ethenyl-3-methyl-1,3,4,5,6,9-hexahydropyrido[3,4-b]indole |
| SMILES | C=CC1=Cc2[nH]c3c(c2CC1)C[C@@H](C)N(CC(C)(F)F)C3c1c(F)cc(C)cc1F |
| InChI | InChI=1S/C24H26F4N2/c1-5-15-6-7-16-17-10-14(3)30(12-24(4,27)28)23(22(17)29-20(16)11-15)21-18(25)8-13(2)9-19(21)26/h5,8-9,11,14,23,29H,1,6-7,10,12H2,2-4H3/t14-,23?/m1/s1 |
| InChIKey | FKXARTVCCIPMOP-PDNQZYNLSA-N |
| XLogP | 6.11 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |