C23H29FN2O4 — CID 166635512
4-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxybutanamide (PubChem CID 166635512) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxybutanamide.
| Compound Name | 4-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 166635512 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxybutanamide |
| SMILES | CC(C)(F)CN1CCc2cc(O)ccc2C1c1ccc(OCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C23H29FN2O4/c1-23(2,24)15-26-12-11-17-14-18(27)7-10-20(17)22(26)16-5-8-19(9-6-16)30-13-3-4-21(28)25-29/h5-10,14,22,27,29H,3-4,11-13,15H2,1-2H3,(H,25,28) |
| InChIKey | JTBIZCVVHIYYIT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|