C27H37FN2O4 — CID 166630229
8-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxyoctanamide (PubChem CID 166630229) has the molecular formula C27H37FN2O4 and a molecular weight of 472.60 g/mol. Its IUPAC name is 8-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxyoctanamide.
| Compound Name | 8-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 166630229 |
| Molecular Formula | C27H37FN2O4 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 8-[4-[2-(2-fluoro-2-methylpropyl)-6-hydroxy-3,4-dihydro-1H-isoquinolin-1-yl]phenoxy]-N-hydroxyoctanamide |
| SMILES | CC(C)(F)CN1CCc2cc(O)ccc2C1c1ccc(OCCCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C27H37FN2O4/c1-27(2,28)19-30-16-15-21-18-22(31)11-14-24(21)26(30)20-9-12-23(13-10-20)34-17-7-5-3-4-6-8-25(32)29-33/h9-14,18,26,31,33H,3-8,15-17,19H2,1-2H3,(H,29,32) |
| InChIKey | KBUBTKSEEWUEDG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|