C8H9ClO2 — CID 164926116
methyl 6-chlorocyclohexa-1,5-diene-1-carboxylate (PubChem CID 164926116) has the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. Its IUPAC name is methyl 6-chlorocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 6-chlorocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 164926116 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | methyl 6-chlorocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCCC=C1Cl |
| InChI | InChI=1S/C8H9ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h4-5H,2-3H2,1H3 |
| InChIKey | YFGBKDXGKLLIBW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |