C29H31FO6 — CID 164929052
[(3S,4S,5R,6R)-4,5-bis[deuterio(phenyl)methoxy]-6-[[deuterio(phenyl)methoxy]methyl]-2-fluorooxan-3-yl] acetate (PubChem CID 164929052) has the molecular formula C29H31FO6 and a molecular weight of 497.58 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-bis[deuterio(phenyl)methoxy]-6-[[deuterio(phenyl)methoxy]methyl]-2-fluorooxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-bis[deuterio(phenyl)methoxy]-6-[[deuterio(phenyl)methoxy]methyl]-2-fluorooxan-3-yl] acetate |
|---|---|
| PubChem CID | 164929052 |
| Molecular Formula | C29H31FO6 |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-bis[deuterio(phenyl)methoxy]-6-[[deuterio(phenyl)methoxy]methyl]-2-fluorooxan-3-yl] acetate |
| SMILES | [2H]C(OC[C@H]1OC(F)[C@@H](OC(C)=O)[C@@H](OC([2H])c2ccccc2)[C@@H]1OC([2H])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31FO6/c1-21(31)35-28-27(34-19-24-15-9-4-10-16-24)26(33-18-23-13-7-3-8-14-23)25(36-29(28)30)20-32-17-22-11-5-2-6-12-22/h2-16,25-29H,17-20H2,1H3/t25-,26-,27+,28+,29?/m1/s1/i17D,18D,19D/t17?,18?,19?,25-,26-,27+,28+,29? |
| InChIKey | RPTZOBJLGGXFAC-PPELQVHPSA-N |
| XLogP | 5.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |