C34H35IO5 — CID 172907466
(2R,3S,4S,5R)-3,4,5-tris[deuterio(phenyl)methoxy]-2-[[deuterio(phenyl)methoxy]methyl]-6-iodooxane (PubChem CID 172907466) has the molecular formula C34H35IO5 and a molecular weight of 654.58 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3,4,5-tris[deuterio(phenyl)methoxy]-2-[[deuterio(phenyl)methoxy]methyl]-6-iodooxane.
| Compound Name | (2R,3S,4S,5R)-3,4,5-tris[deuterio(phenyl)methoxy]-2-[[deuterio(phenyl)methoxy]methyl]-6-iodooxane |
|---|---|
| PubChem CID | 172907466 |
| Molecular Formula | C34H35IO5 |
| Molecular Weight | 654.58 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | (2R,3S,4S,5R)-3,4,5-tris[deuterio(phenyl)methoxy]-2-[[deuterio(phenyl)methoxy]methyl]-6-iodooxane |
| SMILES | [2H]C(OC[C@H]1OC(I)[C@H](OC([2H])c2ccccc2)[C@@H](OC([2H])c2ccccc2)[C@H]1OC([2H])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H35IO5/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-34H,21-25H2/t30-,31+,32+,33-,34?/m1/s1/i21D,22D,23D,24D/t21?,22?,23?,24?,30-,31+,32+,33-,34? |
| InChIKey | JJQMCIYEJMJTFX-LRDMMQSKSA-N |
| XLogP | 7.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|