C14H11Cl2FN2O3 — CID 164930206
methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-2-phenylacetate (PubChem CID 164930206) has the molecular formula C14H11Cl2FN2O3 and a molecular weight of 345.16 g/mol. Its IUPAC name is methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-2-phenylacetate |
|---|---|
| PubChem CID | 164930206 |
| Molecular Formula | C14H11Cl2FN2O3 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | methyl (2R)-2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-2-phenylacetate |
| SMILES | COC(=O)[C@H](Oc1nc(F)c(Cl)c(N)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl2FN2O3/c1-21-14(20)11(7-5-3-2-4-6-7)22-13-9(16)10(18)8(15)12(17)19-13/h2-6,11H,1H3,(H2,18,19)/t11-/m1/s1 |
| InChIKey | POJZKFRSJHZMJF-LLVKDONJSA-N |
| XLogP | 3.40 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|