C29H47N7O9 — CID 164931464
3-[(7S,13S,22S)-13-(3-amino-3-oxopropyl)-16-(2-methylpropyl)-8,9,12,15,18,21-hexaoxo-1,6,11,14,17,20-hexazabicyclo[20.3.0]pentacosan-7-yl]propanoic acid (PubChem CID 164931464) has the molecular formula C29H47N7O9 and a molecular weight of 637.74 g/mol. Its IUPAC name is 3-[(7S,13S,22S)-13-(3-amino-3-oxopropyl)-16-(2-methylpropyl)-8,9,12,15,18,21-hexaoxo-1,6,11,14,17,20-hexazabicyclo[20.3.0]pentacosan-7-yl]propanoic acid.
| Compound Name | 3-[(7S,13S,22S)-13-(3-amino-3-oxopropyl)-16-(2-methylpropyl)-8,9,12,15,18,21-hexaoxo-1,6,11,14,17,20-hexazabicyclo[20.3.0]pentacosan-7-yl]propanoic acid |
|---|---|
| PubChem CID | 164931464 |
| Molecular Formula | C29H47N7O9 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | 3-[(7S,13S,22S)-13-(3-amino-3-oxopropyl)-16-(2-methylpropyl)-8,9,12,15,18,21-hexaoxo-1,6,11,14,17,20-hexazabicyclo[20.3.0]pentacosan-7-yl]propanoic acid |
| SMILES | CC(C)CC1NC(=O)CNC(=O)[C@@H]2CCCN2CCCCN[C@@H](CCC(=O)O)C(=O)C(=O)CNC(=O)[C@H](CCC(N)=O)NC1=O |
| InChI | InChI=1S/C29H47N7O9/c1-17(2)14-20-28(44)35-19(7-9-23(30)38)27(43)32-15-22(37)26(42)18(8-10-25(40)41)31-11-3-4-12-36-13-5-6-21(36)29(45)33-16-24(39)34-20/h17-21,31H,3-16H2,1-2H3,(H2,30,38)(H,32,43)(H,33,45)(H,34,39)(H,35,44)(H,40,41)/t18-,19-,20?,21-/m0/s1 |
| InChIKey | FQLFCUOXHOJVMN-GEMXJRIASA-N |
| XLogP | -2.28 |
| TPSA | 246.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|