C47H27F3N2OPt — CID 164939603
platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-4-tetraphenylen-2-yl-5-(trifluoromethyl)pyridine (PubChem CID 164939603) has the molecular formula C47H27F3N2OPt and a molecular weight of 887.82 g/mol. Its IUPAC name is platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-4-tetraphenylen-2-yl-5-(trifluoromethyl)pyridine.
| Compound Name | platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-4-tetraphenylen-2-yl-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 164939603 |
| Molecular Formula | C47H27F3N2OPt |
| Molecular Weight | 887.82 g/mol |
| Exact Mass | 887.17 |
| IUPAC Name | platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-4-tetraphenylen-2-yl-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(-c2[c-]c(Oc3[c-]c(-c4ccccn4)ccc3)ccc2)cc1-c1ccc2c(c1)-c1ccccc1-c1ccccc1-c1ccccc1-2.[Pt+2] |
| InChI | InChI=1S/C47H27F3N2O.Pt/c48-47(49,50)44-29-52-46(32-12-10-14-34(26-32)53-33-13-9-11-31(25-33)45-21-7-8-24-51-45)28-42(44)30-22-23-41-39-19-4-3-17-37(39)35-15-1-2-16-36(35)38-18-5-6-20-40(38)43(41)27-30;/h1-24,27-29H;/q-2;+2/b37-35-,38-36-,41-39-,43-40-; |
| InChIKey | TZBQBYWKGCWFKH-HUNISIJZSA-N |
| XLogP | 12.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.82 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|