C28H22FN3O4S — CID 164941900
[3-(3-fluorophenyl)sulfonyl-2-naphthalen-1-ylbenzimidazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 164941900) has the molecular formula C28H22FN3O4S and a molecular weight of 515.57 g/mol. Its IUPAC name is [3-(3-fluorophenyl)sulfonyl-2-naphthalen-1-ylbenzimidazol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [3-(3-fluorophenyl)sulfonyl-2-naphthalen-1-ylbenzimidazol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 164941900 |
| Molecular Formula | C28H22FN3O4S |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | [3-(3-fluorophenyl)sulfonyl-2-naphthalen-1-ylbenzimidazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc2nc(-c3cccc4ccccc34)n(S(=O)(=O)c3cccc(F)c3)c2c1)N1CCOCC1 |
| InChI | InChI=1S/C28H22FN3O4S/c29-21-7-4-8-22(18-21)37(34,35)32-26-17-20(28(33)31-13-15-36-16-14-31)11-12-25(26)30-27(32)24-10-3-6-19-5-1-2-9-23(19)24/h1-12,17-18H,13-16H2 |
| InChIKey | NBYUKODNAQOPIL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |