C15H21ClN4O5 — CID 164942076
tert-butyl 2-[[(6-chloro-3-formyloxypyridazin-4-yl)amino]methyl]morpholine-4-carboxylate (PubChem CID 164942076) has the molecular formula C15H21ClN4O5 and a molecular weight of 372.81 g/mol. Its IUPAC name is tert-butyl 2-[[(6-chloro-3-formyloxypyridazin-4-yl)amino]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[(6-chloro-3-formyloxypyridazin-4-yl)amino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 164942076 |
| Molecular Formula | C15H21ClN4O5 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | tert-butyl 2-[[(6-chloro-3-formyloxypyridazin-4-yl)amino]methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(CNc2cc(Cl)nnc2OC=O)C1 |
| InChI | InChI=1S/C15H21ClN4O5/c1-15(2,3)25-14(22)20-4-5-23-10(8-20)7-17-11-6-12(16)18-19-13(11)24-9-21/h6,9-10H,4-5,7-8H2,1-3H3,(H,17,18) |
| InChIKey | VBCKQNOCPFGNML-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|