C12H15N4O2+ — CID 164942775
2-(2H-triazol-4-yl)ethyl 3-pyridin-1-ium-1-ylpropanoate (PubChem CID 164942775) has the molecular formula C12H15N4O2+ and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-(2H-triazol-4-yl)ethyl 3-pyridin-1-ium-1-ylpropanoate.
| Compound Name | 2-(2H-triazol-4-yl)ethyl 3-pyridin-1-ium-1-ylpropanoate |
|---|---|
| PubChem CID | 164942775 |
| Molecular Formula | C12H15N4O2+ |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-(2H-triazol-4-yl)ethyl 3-pyridin-1-ium-1-ylpropanoate |
| SMILES | O=C(CC[n+]1ccccc1)OCCc1cn[nH]n1 |
| InChI | InChI=1S/C12H15N4O2/c17-12(4-8-16-6-2-1-3-7-16)18-9-5-11-10-13-15-14-11/h1-3,6-7,10H,4-5,8-9H2,(H,13,14,15)/q+1 |
| InChIKey | XVDSJOMYQTVHNW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|