C18H24O3 — CID 164944024
2-methylprop-2-enoxymethyl (Z)-2,3-di(cyclopenten-1-yl)prop-2-enoate (PubChem CID 164944024) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-methylprop-2-enoxymethyl (Z)-2,3-di(cyclopenten-1-yl)prop-2-enoate.
| Compound Name | 2-methylprop-2-enoxymethyl (Z)-2,3-di(cyclopenten-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 164944024 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-methylprop-2-enoxymethyl (Z)-2,3-di(cyclopenten-1-yl)prop-2-enoate |
| SMILES | C=C(C)COCOC(=O)/C(=C\C1=CCCC1)C1=CCCC1 |
| InChI | InChI=1S/C18H24O3/c1-14(2)12-20-13-21-18(19)17(16-9-5-6-10-16)11-15-7-3-4-8-15/h7,9,11H,1,3-6,8,10,12-13H2,2H3/b17-11- |
| InChIKey | WFLADGQROBVOBK-BOPFTXTBSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|