C19H29NO3 — CID 4009869
ethyl 2-acetyl-5-(cyclohexen-1-yl)-5-(diethylamino)penta-2,4-dienoate (PubChem CID 4009869) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is ethyl 2-acetyl-5-(cyclohexen-1-yl)-5-(diethylamino)penta-2,4-dienoate.
| Compound Name | ethyl 2-acetyl-5-(cyclohexen-1-yl)-5-(diethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 4009869 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | ethyl 2-acetyl-5-(cyclohexen-1-yl)-5-(diethylamino)penta-2,4-dienoate |
| SMILES | CCOC(=O)C(=CC=C(C1=CCCCC1)N(CC)CC)C(C)=O |
| InChI | InChI=1S/C19H29NO3/c1-5-20(6-2)18(16-11-9-8-10-12-16)14-13-17(15(4)21)19(22)23-7-3/h11,13-14H,5-10,12H2,1-4H3 |
| InChIKey | UBHQMZRWDBEUCZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|