C11H14N2O5 — CID 164948073
1-[(2R,3S,5S)-5-deuteriocarbonyl-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 164948073) has the molecular formula C11H14N2O5 and a molecular weight of 255.25 g/mol. Its IUPAC name is 1-[(2R,3S,5S)-5-deuteriocarbonyl-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5S)-5-deuteriocarbonyl-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164948073 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-[(2R,3S,5S)-5-deuteriocarbonyl-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C(=O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](OC)C1C |
| InChI | InChI=1S/C11H14N2O5/c1-6-7(5-14)18-10(9(6)17-2)13-4-3-8(15)12-11(13)16/h3-7,9-10H,1-2H3,(H,12,15,16)/t6?,7-,9+,10-/m1/s1/i5D |
| InChIKey | SVVONHJXUWCYAG-RXQJSLCWSA-N |
| XLogP | -0.72 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|