C18H17NO3S — CID 164950352
7-acetyl-6-methoxy-4-(2-phenylethyl)thieno[3,2-b]pyridin-5-one (PubChem CID 164950352) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 7-acetyl-6-methoxy-4-(2-phenylethyl)thieno[3,2-b]pyridin-5-one.
| Compound Name | 7-acetyl-6-methoxy-4-(2-phenylethyl)thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 164950352 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 7-acetyl-6-methoxy-4-(2-phenylethyl)thieno[3,2-b]pyridin-5-one |
| SMILES | COc1c(C(C)=O)c2sccc2n(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C18H17NO3S/c1-12(20)15-16(22-2)18(21)19(14-9-11-23-17(14)15)10-8-13-6-4-3-5-7-13/h3-7,9,11H,8,10H2,1-2H3 |
| InChIKey | NDVAFJFJYKXYQF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |