C17H14N2O5S — CID 165011394
7-acetyl-6-methoxy-4-[(3-nitrophenyl)methyl]thieno[3,2-b]pyridin-5-one (PubChem CID 165011394) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 7-acetyl-6-methoxy-4-[(3-nitrophenyl)methyl]thieno[3,2-b]pyridin-5-one.
| Compound Name | 7-acetyl-6-methoxy-4-[(3-nitrophenyl)methyl]thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 165011394 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 7-acetyl-6-methoxy-4-[(3-nitrophenyl)methyl]thieno[3,2-b]pyridin-5-one |
| SMILES | COc1c(C(C)=O)c2sccc2n(Cc2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C17H14N2O5S/c1-10(20)14-15(24-2)17(21)18(13-6-7-25-16(13)14)9-11-4-3-5-12(8-11)19(22)23/h3-8H,9H2,1-2H3 |
| InChIKey | LDLWEKYPJPVLQA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|