C10H12F6O4 — CID 164954990
2,2-difluoro-4-methyl-3-(2,2,3,3-tetrafluorobutanoyloxy)pentanoic acid (PubChem CID 164954990) has the molecular formula C10H12F6O4 and a molecular weight of 310.19 g/mol. Its IUPAC name is 2,2-difluoro-4-methyl-3-(2,2,3,3-tetrafluorobutanoyloxy)pentanoic acid.
| Compound Name | 2,2-difluoro-4-methyl-3-(2,2,3,3-tetrafluorobutanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 164954990 |
| Molecular Formula | C10H12F6O4 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2,2-difluoro-4-methyl-3-(2,2,3,3-tetrafluorobutanoyloxy)pentanoic acid |
| SMILES | CC(C)C(OC(=O)C(F)(F)C(C)(F)F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C10H12F6O4/c1-4(2)5(9(13,14)6(17)18)20-7(19)10(15,16)8(3,11)12/h4-5H,1-3H3,(H,17,18) |
| InChIKey | VOPANXDGVLMYPW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|