C16H23NO4 — CID 164959426
1-[2-hydroxy-3-[(3S)-3-hydroxy-1-methylpiperidin-4-yl]-6-methoxy-4-methylphenyl]ethanone (PubChem CID 164959426) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1-[2-hydroxy-3-[(3S)-3-hydroxy-1-methylpiperidin-4-yl]-6-methoxy-4-methylphenyl]ethanone.
| Compound Name | 1-[2-hydroxy-3-[(3S)-3-hydroxy-1-methylpiperidin-4-yl]-6-methoxy-4-methylphenyl]ethanone |
|---|---|
| PubChem CID | 164959426 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-[2-hydroxy-3-[(3S)-3-hydroxy-1-methylpiperidin-4-yl]-6-methoxy-4-methylphenyl]ethanone |
| SMILES | COc1cc(C)c(C2CCN(C)C[C@H]2O)c(O)c1C(C)=O |
| InChI | InChI=1S/C16H23NO4/c1-9-7-13(21-4)15(10(2)18)16(20)14(9)11-5-6-17(3)8-12(11)19/h7,11-12,19-20H,5-6,8H2,1-4H3/t11?,12-/m1/s1 |
| InChIKey | VWXGCKHVQWUMRK-PIJUOVFKSA-N |
| XLogP | 1.69 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |