C21H35NO4 — CID 144551765
6-methoxy-2,3-dimethylphenol;methoxymethane;2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one (PubChem CID 144551765) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 6-methoxy-2,3-dimethylphenol;methoxymethane;2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one.
| Compound Name | 6-methoxy-2,3-dimethylphenol;methoxymethane;2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 144551765 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 6-methoxy-2,3-dimethylphenol;methoxymethane;2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
| SMILES | CN1CCC2CC(=O)CCC2C1.COC.COc1ccc(C)c(C)c1O |
| InChI | InChI=1S/C10H17NO.C9H12O2.C2H6O/c1-11-5-4-8-6-10(12)3-2-9(8)7-11;1-6-4-5-8(11-3)9(10)7(6)2;1-3-2/h8-9H,2-7H2,1H3;4-5,10H,1-3H3;1-2H3 |
| InChIKey | ZTHOOWTUOALLBG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |