C19H23NO3 — CID 138713848
(1S,4S,5R,10S)-12-hydroxy-13-methoxy-3-methyl-3-azapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-trien-8-one (PubChem CID 138713848) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (1S,4S,5R,10S)-12-hydroxy-13-methoxy-3-methyl-3-azapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-trien-8-one.
| Compound Name | (1S,4S,5R,10S)-12-hydroxy-13-methoxy-3-methyl-3-azapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-trien-8-one |
|---|---|
| PubChem CID | 138713848 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (1S,4S,5R,10S)-12-hydroxy-13-methoxy-3-methyl-3-azapentacyclo[8.7.1.01,4.05,10.011,16]octadeca-11(16),12,14-trien-8-one |
| SMILES | COc1ccc2c(c1O)[C@@]13CC(=O)CC[C@H]1[C@@H]1N(C)C[C@]1(C2)C3 |
| InChI | InChI=1S/C19H23NO3/c1-20-10-18-7-11-3-6-14(23-2)16(22)15(11)19(9-18)8-12(21)4-5-13(19)17(18)20/h3,6,13,17,22H,4-5,7-10H2,1-2H3/t13-,17-,18-,19+/m0/s1 |
| InChIKey | CJEZIILKCLEQPE-ZQEOTTOMSA-N |
| XLogP | 2.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |