C24H13Cl5F6N2O2 — CID 164959559
2,3-dichloro-4-[4-(trifluoromethyl)phenoxy]pyridine;2,3,4-trichloropyridine;4-(trifluoromethyl)phenol (PubChem CID 164959559) has the molecular formula C24H13Cl5F6N2O2 and a molecular weight of 652.63 g/mol. Its IUPAC name is 2,3-dichloro-4-[4-(trifluoromethyl)phenoxy]pyridine;2,3,4-trichloropyridine;4-(trifluoromethyl)phenol.
| Compound Name | 2,3-dichloro-4-[4-(trifluoromethyl)phenoxy]pyridine;2,3,4-trichloropyridine;4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 164959559 |
| Molecular Formula | C24H13Cl5F6N2O2 |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 649.93 |
| IUPAC Name | 2,3-dichloro-4-[4-(trifluoromethyl)phenoxy]pyridine;2,3,4-trichloropyridine;4-(trifluoromethyl)phenol |
| SMILES | Clc1ccnc(Cl)c1Cl.FC(F)(F)c1ccc(Oc2ccnc(Cl)c2Cl)cc1.Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H6Cl2F3NO.C7H5F3O.C5H2Cl3N/c13-10-9(5-6-18-11(10)14)19-8-3-1-7(2-4-8)12(15,16)17;8-7(9,10)5-1-3-6(11)4-2-5;6-3-1-2-9-5(8)4(3)7/h1-6H;1-4,11H;1-2H |
| InChIKey | BQJIUXDJWZWQTC-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|