C11H17N — CID 164962160
2-[1-[(E)-but-2-enyl]cyclopropyl]-3-methyl-2,3-dihydroazete (PubChem CID 164962160) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-[1-[(E)-but-2-enyl]cyclopropyl]-3-methyl-2,3-dihydroazete.
| Compound Name | 2-[1-[(E)-but-2-enyl]cyclopropyl]-3-methyl-2,3-dihydroazete |
|---|---|
| PubChem CID | 164962160 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-[1-[(E)-but-2-enyl]cyclopropyl]-3-methyl-2,3-dihydroazete |
| SMILES | C/C=C/CC1(C2N=CC2C)CC1 |
| InChI | InChI=1S/C11H17N/c1-3-4-5-11(6-7-11)10-9(2)8-12-10/h3-4,8-10H,5-7H2,1-2H3/b4-3+ |
| InChIKey | BZIVIJNPZIXZRS-ONEGZZNKSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|