C21H20FNO2 — CID 164970350
[2-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone (PubChem CID 164970350) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is [2-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | [2-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164970350 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-fluoro-4-[2-(4-methylphenyl)ethynyl]phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone |
| SMILES | Cc1ccc(C#Cc2ccc(C(=O)N3CCC[C@@H](O)C3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H20FNO2/c1-15-4-6-16(7-5-15)8-9-17-10-11-19(20(22)13-17)21(25)23-12-2-3-18(24)14-23/h4-7,10-11,13,18,24H,2-3,12,14H2,1H3/t18-/m1/s1 |
| InChIKey | DAPKYMYWIRLPTF-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|