C18H25N — CID 164977836
(2R)-3-methyl-N-[1-(3-phenyl-1-bicyclo[1.1.1]pentanyl)ethenyl]butan-2-amine (PubChem CID 164977836) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is (2R)-3-methyl-N-[1-(3-phenyl-1-bicyclo[1.1.1]pentanyl)ethenyl]butan-2-amine.
| Compound Name | (2R)-3-methyl-N-[1-(3-phenyl-1-bicyclo[1.1.1]pentanyl)ethenyl]butan-2-amine |
|---|---|
| PubChem CID | 164977836 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (2R)-3-methyl-N-[1-(3-phenyl-1-bicyclo[1.1.1]pentanyl)ethenyl]butan-2-amine |
| SMILES | C=C(N[C@H](C)C(C)C)C12CC(c3ccccc3)(C1)C2 |
| InChI | InChI=1S/C18H25N/c1-13(2)14(3)19-15(4)17-10-18(11-17,12-17)16-8-6-5-7-9-16/h5-9,13-14,19H,4,10-12H2,1-3H3/t14-,17?,18?/m1/s1 |
| InChIKey | AHMOQVSWPGPYBV-RWBZWWBESA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |