C19H24N4O4 — CID 164983668
7-[(2R,3S,5R)-5-ethyl-5-ethynyl-3-hydroxy-4-methyloxolan-2-yl]-2-(3-methyl-2-oxobutyl)-1H-purin-6-one (PubChem CID 164983668) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 7-[(2R,3S,5R)-5-ethyl-5-ethynyl-3-hydroxy-4-methyloxolan-2-yl]-2-(3-methyl-2-oxobutyl)-1H-purin-6-one.
| Compound Name | 7-[(2R,3S,5R)-5-ethyl-5-ethynyl-3-hydroxy-4-methyloxolan-2-yl]-2-(3-methyl-2-oxobutyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 164983668 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 7-[(2R,3S,5R)-5-ethyl-5-ethynyl-3-hydroxy-4-methyloxolan-2-yl]-2-(3-methyl-2-oxobutyl)-1H-purin-6-one |
| SMILES | C#C[C@]1(CC)O[C@@H](n2cnc3nc(CC(=O)C(C)C)[nH]c(=O)c32)[C@@H](O)C1C |
| InChI | InChI=1S/C19H24N4O4/c1-6-19(7-2)11(5)15(25)18(27-19)23-9-20-16-14(23)17(26)22-13(21-16)8-12(24)10(3)4/h1,9-11,15,18,25H,7-8H2,2-5H3,(H,21,22,26)/t11?,15-,18+,19+/m0/s1 |
| InChIKey | SEKUTDFUFAHITL-SHSSGECISA-N |
| XLogP | 1.20 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|