C35H48N4O13S2 — CID 164984053
(2R)-2-[2-[2-[2-[2-[(1-ethyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxymethylcarbamoyl]-4-[3-[3-(4-methylphenyl)sulfonylpropanoyl]phenyl]-4-oxobutane-1-sulfonic acid (PubChem CID 164984053) has the molecular formula C35H48N4O13S2 and a molecular weight of 796.92 g/mol. Its IUPAC name is (2R)-2-[2-[2-[2-[2-[(1-ethyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxymethylcarbamoyl]-4-[3-[3-(4-methylphenyl)sulfonylpropanoyl]phenyl]-4-oxobutane-1-sulfonic acid.
| Compound Name | (2R)-2-[2-[2-[2-[2-[(1-ethyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxymethylcarbamoyl]-4-[3-[3-(4-methylphenyl)sulfonylpropanoyl]phenyl]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 164984053 |
| Molecular Formula | C35H48N4O13S2 |
| Molecular Weight | 796.92 g/mol |
| Exact Mass | 796.27 |
| IUPAC Name | (2R)-2-[2-[2-[2-[2-[(1-ethyltriazol-4-yl)methoxy]ethoxy]ethoxy]ethoxy]ethoxymethylcarbamoyl]-4-[3-[3-(4-methylphenyl)sulfonylpropanoyl]phenyl]-4-oxobutane-1-sulfonic acid |
| SMILES | CCn1cc(COCCOCCOCCOCCOCNC(=O)[C@@H](CC(=O)c2cccc(C(=O)CCS(=O)(=O)c3ccc(C)cc3)c2)CS(=O)(=O)O)nn1 |
| InChI | InChI=1S/C35H48N4O13S2/c1-3-39-23-31(37-38-39)24-51-18-16-49-14-12-48-13-15-50-17-19-52-26-36-35(42)30(25-54(45,46)47)22-34(41)29-6-4-5-28(21-29)33(40)11-20-53(43,44)32-9-7-27(2)8-10-32/h4-10,21,23,30H,3,11-20,22,24-26H2,1-2H3,(H,36,42)(H,45,46,47)/t30-/m0/s1 |
| InChIKey | LOYLSHZTMCLXEZ-PMERELPUSA-N |
| XLogP | 2.09 |
| TPSA | 228.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.92 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|