C18H21N5O — CID 164984428
N-[3-(1H-benzimidazol-2-yl)-2H-pyrrol-5-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 164984428) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-2H-pyrrol-5-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-2H-pyrrol-5-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 164984428 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-2H-pyrrol-5-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NC2=NCC(c3nc4ccccc4[nH]3)=C2)CC1 |
| InChI | InChI=1S/C18H21N5O/c1-23-8-6-12(7-9-23)18(24)22-16-10-13(11-19-16)17-20-14-4-2-3-5-15(14)21-17/h2-5,10,12H,6-9,11H2,1H3,(H,20,21)(H,19,22,24) |
| InChIKey | FYKRJTQCLZBLQX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |